C18H24Cl2N6O2 — CID 71437829
amino-[2-[2-[4-[(2-chloro-4-nitrophenyl)diazenyl]phenyl]ethylamino]ethyl]-dimethylazanium chloride (PubChem CID 71437829) has the molecular formula C18H24Cl2N6O2 and a molecular weight of 427.34 g/mol. Its IUPAC name is amino-[2-[2-[4-[(2-chloro-4-nitrophenyl)diazenyl]phenyl]ethylamino]ethyl]-dimethylazanium chloride.
| Compound Name | amino-[2-[2-[4-[(2-chloro-4-nitrophenyl)diazenyl]phenyl]ethylamino]ethyl]-dimethylazanium chloride |
|---|---|
| PubChem CID | 71437829 |
| Molecular Formula | C18H24Cl2N6O2 |
| Molecular Weight | 427.34 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | amino-[2-[2-[4-[(2-chloro-4-nitrophenyl)diazenyl]phenyl]ethylamino]ethyl]-dimethylazanium chloride |
| SMILES | C[N+](C)(N)CCNCCc1ccc(/N=N/c2ccc([N+](=O)[O-])cc2Cl)cc1.[Cl-] |
| InChI | InChI=1S/C18H24ClN6O2.ClH/c1-25(2,20)12-11-21-10-9-14-3-5-15(6-4-14)22-23-18-8-7-16(24(26)27)13-17(18)19;/h3-8,13,21H,9-12,20H2,1-2H3;1H/q+1;/p-1/b23-22+; |
| InChIKey | KQRJGSGNOXGTID-PGCQSHBKSA-M |
| XLogP | 0.75 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.34 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|