About hydrogen sulfate;2-methylsulfonyl-4-nitrobenzenediazonium
hydrogen sulfate;2-methylsulfonyl-4-nitrobenzenediazonium (PubChem CID 71374569) has the molecular formula C7H7N3O8S2
and a molecular weight of 325.28 g/mol. Its IUPAC name is hydrogen sulfate;2-methylsulfonyl-4-nitrobenzenediazonium.
Molecular Properties
| Compound Name | hydrogen sulfate;2-methylsulfonyl-4-nitrobenzenediazonium |
| PubChem CID | 71374569 |
| Molecular Formula | C7H7N3O8S2 |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 324.97 |
| IUPAC Name | hydrogen sulfate;2-methylsulfonyl-4-nitrobenzenediazonium |
| SMILES | CS(=O)(=O)c1cc([N+](=O)[O-])ccc1[N+]#N.O=S(=O)([O-])O |
| InChI | InChI=1S/C7H6N3O4S.H2O4S/c1-15(13,14)7-4-5(10(11)12)2-3-6(7)9-8;1-5(2,3)4/h2-4H,1H3;(H2,1,2,3,4)/q+1;/p-1 |
| InChIKey | LGYRUJPYKXXPRG-UHFFFAOYSA-M |
| XLogP | 0.49 |
| TPSA | 182.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze hydrogen sulfate;2-methylsulfonyl-4-nitrobenzenediazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrogen sulfate;2-methylsulfonyl-4-nitrobenzenediazonium?
The IUPAC name of hydrogen sulfate;2-methylsulfonyl-4-nitrobenzenediazonium (CID 71374569) is hydrogen sulfate;2-methylsulfonyl-4-nitrobenzenediazonium.
What is the SMILES notation for hydrogen sulfate;2-methylsulfonyl-4-nitrobenzenediazonium?
The canonical SMILES for hydrogen sulfate;2-methylsulfonyl-4-nitrobenzenediazonium is CS(=O)(=O)c1cc([N+](=O)[O-])ccc1[N+]#N.O=S(=O)([O-])O.
What is the InChIKey of hydrogen sulfate;2-methylsulfonyl-4-nitrobenzenediazonium?
The InChIKey is LGYRUJPYKXXPRG-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6N3O4S.H2O4S/c1-15(13,14)7-4-5(10(11)12)2-3-6(7)9-8;1-5(2,3)4/h2-4H,1H3;(H2,1,2,3,4)/q+1;/p-1.
What are the key properties of hydrogen sulfate;2-methylsulfonyl-4-nitrobenzenediazonium?
hydrogen sulfate;2-methylsulfonyl-4-nitrobenzenediazonium has a molecular weight of 325.28 g/mol, XLogP of 0.49, 2 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen sulfate;2-methylsulfonyl-4-nitrobenzenediazonium is sourced from PubChem (CID 71374569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).