About boric acid;dihydrogen borate;2-methoxy-4-nitrobenzenediazonium
boric acid;dihydrogen borate;2-methoxy-4-nitrobenzenediazonium (PubChem CID 173223766) has the molecular formula C7H17B4N3O15
and a molecular weight of 426.47 g/mol. Its IUPAC name is boric acid;dihydrogen borate;2-methoxy-4-nitrobenzenediazonium.
Molecular Properties
| Compound Name | boric acid;dihydrogen borate;2-methoxy-4-nitrobenzenediazonium |
| PubChem CID | 173223766 |
| Molecular Formula | C7H17B4N3O15 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | boric acid;dihydrogen borate;2-methoxy-4-nitrobenzenediazonium |
| SMILES | COc1cc([N+](=O)[O-])ccc1[N+]#N.OB(O)O.OB(O)O.OB(O)O.[O-]B(O)O |
| InChI | InChI=1S/C7H6N3O3.3BH3O3.BH2O3/c1-13-7-4-5(10(11)12)2-3-6(7)9-8;4*2-1(3)4/h2-4H,1H3;3*2-4H;2-3H/q+1;;;;-1 |
| InChIKey | XDJLKHRJLMOMMZ-UHFFFAOYSA-N |
| XLogP | -6.75 |
| TPSA | 326.11 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | -6.75 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 16 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze boric acid;dihydrogen borate;2-methoxy-4-nitrobenzenediazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;dihydrogen borate;2-methoxy-4-nitrobenzenediazonium?
The IUPAC name of boric acid;dihydrogen borate;2-methoxy-4-nitrobenzenediazonium (CID 173223766) is boric acid;dihydrogen borate;2-methoxy-4-nitrobenzenediazonium.
What is the SMILES notation for boric acid;dihydrogen borate;2-methoxy-4-nitrobenzenediazonium?
The canonical SMILES for boric acid;dihydrogen borate;2-methoxy-4-nitrobenzenediazonium is COc1cc([N+](=O)[O-])ccc1[N+]#N.OB(O)O.OB(O)O.OB(O)O.[O-]B(O)O.
What is the InChIKey of boric acid;dihydrogen borate;2-methoxy-4-nitrobenzenediazonium?
The InChIKey is XDJLKHRJLMOMMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N3O3.3BH3O3.BH2O3/c1-13-7-4-5(10(11)12)2-3-6(7)9-8;4*2-1(3)4/h2-4H,1H3;3*2-4H;2-3H/q+1;;;;-1.
What are the key properties of boric acid;dihydrogen borate;2-methoxy-4-nitrobenzenediazonium?
boric acid;dihydrogen borate;2-methoxy-4-nitrobenzenediazonium has a molecular weight of 426.47 g/mol, XLogP of -6.75, 2 rotatable bonds, 11 hydrogen bond donors, and 16 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;dihydrogen borate;2-methoxy-4-nitrobenzenediazonium is sourced from PubChem (CID 173223766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).