C9H10N2O5 — CID 44632214
N,2-dimethoxy-4-nitrobenzamide (PubChem CID 44632214) has the molecular formula C9H10N2O5 and a molecular weight of 226.19 g/mol. Its IUPAC name is N,2-dimethoxy-4-nitrobenzamide.
| Compound Name | N,2-dimethoxy-4-nitrobenzamide |
|---|---|
| PubChem CID | 44632214 |
| Molecular Formula | C9H10N2O5 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | N,2-dimethoxy-4-nitrobenzamide |
| SMILES | CONC(=O)c1ccc([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C9H10N2O5/c1-15-8-5-6(11(13)14)3-4-7(8)9(12)10-16-2/h3-5H,1-2H3,(H,10,12) |
| InChIKey | UPCMEZKKLAMWDM-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|