C12H14Cl2N2O4 — CID 104784855
N-(1,3-dichloro-2-methylpropan-2-yl)-2-methoxy-4-nitrobenzamide (PubChem CID 104784855) has the molecular formula C12H14Cl2N2O4 and a molecular weight of 321.16 g/mol. Its IUPAC name is N-(1,3-dichloro-2-methylpropan-2-yl)-2-methoxy-4-nitrobenzamide.
| Compound Name | N-(1,3-dichloro-2-methylpropan-2-yl)-2-methoxy-4-nitrobenzamide |
|---|---|
| PubChem CID | 104784855 |
| Molecular Formula | C12H14Cl2N2O4 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | N-(1,3-dichloro-2-methylpropan-2-yl)-2-methoxy-4-nitrobenzamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1C(=O)NC(C)(CCl)CCl |
| InChI | InChI=1S/C12H14Cl2N2O4/c1-12(6-13,7-14)15-11(17)9-4-3-8(16(18)19)5-10(9)20-2/h3-5H,6-7H2,1-2H3,(H,15,17) |
| InChIKey | XPMRLGXYOITOOS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|