C17H15N3O5S2 — CID 123486989
5-[[3-(2-carboxyethylcarbamoyl)phenyl]diazenyl]-2-(disulfanyl)benzoic acid (PubChem CID 123486989) has the molecular formula C17H15N3O5S2 and a molecular weight of 405.46 g/mol. Its IUPAC name is 5-[[3-(2-carboxyethylcarbamoyl)phenyl]diazenyl]-2-(disulfanyl)benzoic acid.
| Compound Name | 5-[[3-(2-carboxyethylcarbamoyl)phenyl]diazenyl]-2-(disulfanyl)benzoic acid |
|---|---|
| PubChem CID | 123486989 |
| Molecular Formula | C17H15N3O5S2 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | 5-[[3-(2-carboxyethylcarbamoyl)phenyl]diazenyl]-2-(disulfanyl)benzoic acid |
| SMILES | O=C(O)CCNC(=O)c1cccc(/N=N/c2ccc(SS)c(C(=O)O)c2)c1 |
| InChI | InChI=1S/C17H15N3O5S2/c21-15(22)6-7-18-16(23)10-2-1-3-11(8-10)19-20-12-4-5-14(27-26)13(9-12)17(24)25/h1-5,8-9,26H,6-7H2,(H,18,23)(H,21,22)(H,24,25)/b20-19+ |
| InChIKey | JFAMIPOMCMZFIO-FMQUCBEESA-N |
| XLogP | 3.94 |
| TPSA | 128.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|