C15H12F2NNaO3 — CID 142689348
sodium 5-[2-(2,6-difluorophenyl)ethylamino]-2-hydroxybenzoate (PubChem CID 142689348) has the molecular formula C15H12F2NNaO3 and a molecular weight of 315.25 g/mol. Its IUPAC name is sodium 5-[2-(2,6-difluorophenyl)ethylamino]-2-hydroxybenzoate.
| Compound Name | sodium 5-[2-(2,6-difluorophenyl)ethylamino]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 142689348 |
| Molecular Formula | C15H12F2NNaO3 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | sodium 5-[2-(2,6-difluorophenyl)ethylamino]-2-hydroxybenzoate |
| SMILES | O=C([O-])c1cc(NCCc2c(F)cccc2F)ccc1O.[Na+] |
| InChI | InChI=1S/C15H13F2NO3.Na/c16-12-2-1-3-13(17)10(12)6-7-18-9-4-5-14(19)11(8-9)15(20)21;/h1-5,8,18-19H,6-7H2,(H,20,21);/q;+1/p-1 |
| InChIKey | XVFCNXWVLCFOSB-UHFFFAOYSA-M |
| XLogP | -1.31 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|