C18H19FN2O3 — CID 44664453
5-[(2-fluorophenyl)methylamino]-2-morpholin-4-ium-4-ylbenzoate (PubChem CID 44664453) has the molecular formula C18H19FN2O3 and a molecular weight of 330.36 g/mol. Its IUPAC name is 5-[(2-fluorophenyl)methylamino]-2-morpholin-4-ium-4-ylbenzoate.
| Compound Name | 5-[(2-fluorophenyl)methylamino]-2-morpholin-4-ium-4-ylbenzoate |
|---|---|
| PubChem CID | 44664453 |
| Molecular Formula | C18H19FN2O3 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 5-[(2-fluorophenyl)methylamino]-2-morpholin-4-ium-4-ylbenzoate |
| SMILES | O=C([O-])c1cc(NCc2ccccc2F)ccc1[NH+]1CCOCC1 |
| InChI | InChI=1S/C18H19FN2O3/c19-16-4-2-1-3-13(16)12-20-14-5-6-17(15(11-14)18(22)23)21-7-9-24-10-8-21/h1-6,11,20H,7-10,12H2,(H,22,23) |
| InChIKey | LQULHDZWJGXHMY-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 65.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|