C16H16KNO4 — CID 142689383
potassium 2-hydroxy-5-[2-(2-methoxyphenyl)ethylamino]benzoate (PubChem CID 142689383) has the molecular formula C16H16KNO4 and a molecular weight of 325.41 g/mol. Its IUPAC name is potassium 2-hydroxy-5-[2-(2-methoxyphenyl)ethylamino]benzoate.
| Compound Name | potassium 2-hydroxy-5-[2-(2-methoxyphenyl)ethylamino]benzoate |
|---|---|
| PubChem CID | 142689383 |
| Molecular Formula | C16H16KNO4 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | potassium 2-hydroxy-5-[2-(2-methoxyphenyl)ethylamino]benzoate |
| SMILES | COc1ccccc1CCNc1ccc(O)c(C(=O)[O-])c1.[K+] |
| InChI | InChI=1S/C16H17NO4.K/c1-21-15-5-3-2-4-11(15)8-9-17-12-6-7-14(18)13(10-12)16(19)20;/h2-7,10,17-18H,8-9H2,1H3,(H,19,20);/q;+1/p-1 |
| InChIKey | QRTDWPRVSIKFMT-UHFFFAOYSA-M |
| XLogP | -1.58 |
| TPSA | 81.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|