C16H14F3NO4 — CID 142683927
2-hydroxy-5-[2-[2-(trifluoromethoxy)phenyl]ethylamino]benzoic acid (PubChem CID 142683927) has the molecular formula C16H14F3NO4 and a molecular weight of 341.29 g/mol. Its IUPAC name is 2-hydroxy-5-[2-[2-(trifluoromethoxy)phenyl]ethylamino]benzoic acid.
| Compound Name | 2-hydroxy-5-[2-[2-(trifluoromethoxy)phenyl]ethylamino]benzoic acid |
|---|---|
| PubChem CID | 142683927 |
| Molecular Formula | C16H14F3NO4 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 2-hydroxy-5-[2-[2-(trifluoromethoxy)phenyl]ethylamino]benzoic acid |
| SMILES | O=C(O)c1cc(NCCc2ccccc2OC(F)(F)F)ccc1O |
| InChI | InChI=1S/C16H14F3NO4/c17-16(18,19)24-14-4-2-1-3-10(14)7-8-20-11-5-6-13(21)12(9-11)15(22)23/h1-6,9,20-21H,7-8H2,(H,22,23) |
| InChIKey | YQWZGKFDYHDASJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|