C17H15N3O8S — CID 135423090
5-[[4-(3-carboxypropanoylsulfamoyl)phenyl]diazenyl]-2-hydroxybenzoic acid (PubChem CID 135423090) has the molecular formula C17H15N3O8S and a molecular weight of 421.39 g/mol. Its IUPAC name is 5-[[4-(3-carboxypropanoylsulfamoyl)phenyl]diazenyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[[4-(3-carboxypropanoylsulfamoyl)phenyl]diazenyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 135423090 |
| Molecular Formula | C17H15N3O8S |
| Molecular Weight | 421.39 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | 5-[[4-(3-carboxypropanoylsulfamoyl)phenyl]diazenyl]-2-hydroxybenzoic acid |
| SMILES | O=C(O)CCC(=O)NS(=O)(=O)c1ccc(/N=N/c2ccc(O)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C17H15N3O8S/c21-14-6-3-11(9-13(14)17(25)26)19-18-10-1-4-12(5-2-10)29(27,28)20-15(22)7-8-16(23)24/h1-6,9,21H,7-8H2,(H,20,22)(H,23,24)(H,25,26)/b19-18+ |
| InChIKey | APJAZCDUSIQPFZ-VHEBQXMUSA-N |
| XLogP | 2.18 |
| TPSA | 182.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|