C32H32N6O15S5 — CID 91075654
3-[[3-amino-5-(methylamino)-2-sulfophenyl]diazenyl]naphthalene-1,5-disulfonic acid;4-[(4-ethyl-2-methylphenyl)diazenyl]benzene-1,3-disulfonic acid (PubChem CID 91075654) has the molecular formula C32H32N6O15S5 and a molecular weight of 900.97 g/mol. Its IUPAC name is 3-[[3-amino-5-(methylamino)-2-sulfophenyl]diazenyl]naphthalene-1,5-disulfonic acid;4-[(4-ethyl-2-methylphenyl)diazenyl]benzene-1,3-disulfonic acid.
| Compound Name | 3-[[3-amino-5-(methylamino)-2-sulfophenyl]diazenyl]naphthalene-1,5-disulfonic acid;4-[(4-ethyl-2-methylphenyl)diazenyl]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 91075654 |
| Molecular Formula | C32H32N6O15S5 |
| Molecular Weight | 900.97 g/mol |
| Exact Mass | 900.05 |
| IUPAC Name | 3-[[3-amino-5-(methylamino)-2-sulfophenyl]diazenyl]naphthalene-1,5-disulfonic acid;4-[(4-ethyl-2-methylphenyl)diazenyl]benzene-1,3-disulfonic acid |
| SMILES | CCc1ccc(/N=N/c2ccc(S(=O)(=O)O)cc2S(=O)(=O)O)c(C)c1.CNc1cc(N)c(S(=O)(=O)O)c(/N=N/c2cc(S(=O)(=O)O)c3cccc(S(=O)(=O)O)c3c2)c1 |
| InChI | InChI=1S/C17H16N4O9S3.C15H16N2O6S2/c1-19-9-6-13(18)17(33(28,29)30)14(7-9)21-20-10-5-12-11(16(8-10)32(25,26)27)3-2-4-15(12)31(22,23)24;1-3-11-4-6-13(10(2)8-11)16-17-14-7-5-12(24(18,19)20)9-15(14)25(21,22)23/h2-8,19H,18H2,1H3,(H,22,23,24)(H,25,26,27)(H,28,29,30);4-9H,3H2,1-2H3,(H,18,19,20)(H,21,22,23)/b21-20+;17-16+ |
| InChIKey | CBKOZAQJVSRNJI-QKVCXMNVSA-N |
| XLogP | 6.09 |
| TPSA | 359.34 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 900.97 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|