C39H30N6O11S3 — CID 160974407
8-[[4-[(6-ethyl-1-hydroxynaphthalen-2-yl)diazenyl]-6-sulfonaphthalen-1-yl]diazenyl]-5-[[4-(hydroxymethyl)-2-sulfophenyl]diazenyl]naphthalene-2-sulfonic acid (PubChem CID 160974407) has the molecular formula C39H30N6O11S3 and a molecular weight of 854.90 g/mol. Its IUPAC name is 8-[[4-[(6-ethyl-1-hydroxynaphthalen-2-yl)diazenyl]-6-sulfonaphthalen-1-yl]diazenyl]-5-[[4-(hydroxymethyl)-2-sulfophenyl]diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 8-[[4-[(6-ethyl-1-hydroxynaphthalen-2-yl)diazenyl]-6-sulfonaphthalen-1-yl]diazenyl]-5-[[4-(hydroxymethyl)-2-sulfophenyl]diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 160974407 |
| Molecular Formula | C39H30N6O11S3 |
| Molecular Weight | 854.90 g/mol |
| Exact Mass | 854.11 |
| IUPAC Name | 8-[[4-[(6-ethyl-1-hydroxynaphthalen-2-yl)diazenyl]-6-sulfonaphthalen-1-yl]diazenyl]-5-[[4-(hydroxymethyl)-2-sulfophenyl]diazenyl]naphthalene-2-sulfonic acid |
| SMILES | CCc1ccc2c(O)c(/N=N/c3ccc(/N=N/c4ccc(/N=N/c5ccc(CO)cc5S(=O)(=O)O)c5ccc(S(=O)(=O)O)cc45)c4ccc(S(=O)(=O)O)cc34)ccc2c1 |
| InChI | InChI=1S/C39H30N6O11S3/c1-2-22-3-8-27-24(17-22)5-12-37(39(27)47)45-43-35-16-13-32(28-9-6-26(20-31(28)35)58(51,52)53)40-42-34-15-14-33(29-10-7-25(19-30(29)34)57(48,49)50)41-44-36-11-4-23(21-46)18-38(36)59(54,55)56/h3-20,46-47H,2,21H2,1H3,(H,48,49,50)(H,51,52,53)(H,54,55,56)/b42-40+,44-41+,45-43+ |
| InChIKey | WRYIWEIEFNSANZ-QLSYXYOKSA-N |
| XLogP | 9.89 |
| TPSA | 277.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.90 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|