C11H9N3O4S2 — CID 135848731
7-(carbamothioyldiazenyl)-8-hydroxynaphthalene-2-sulfonic acid (PubChem CID 135848731) has the molecular formula C11H9N3O4S2 and a molecular weight of 311.34 g/mol. Its IUPAC name is 7-(carbamothioyldiazenyl)-8-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 7-(carbamothioyldiazenyl)-8-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 135848731 |
| Molecular Formula | C11H9N3O4S2 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.00 |
| IUPAC Name | 7-(carbamothioyldiazenyl)-8-hydroxynaphthalene-2-sulfonic acid |
| SMILES | NC(=S)/N=N/c1ccc2ccc(S(=O)(=O)O)cc2c1O |
| InChI | InChI=1S/C11H9N3O4S2/c12-11(19)14-13-9-4-2-6-1-3-7(20(16,17)18)5-8(6)10(9)15/h1-5,15H,(H2,12,19)(H,16,17,18)/b14-13+ |
| InChIKey | PIXZXBSLJSNXEK-BUHFOSPRSA-N |
| XLogP | 2.12 |
| TPSA | 125.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|