C28H18N6O8S2 — CID 146699059
6-[[4-[(4-carbamoyl-3-cyanophenyl)diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]-5-hydroxynaphthalene-1-sulfonic acid (PubChem CID 146699059) has the molecular formula C28H18N6O8S2 and a molecular weight of 630.62 g/mol. Its IUPAC name is 6-[[4-[(4-carbamoyl-3-cyanophenyl)diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]-5-hydroxynaphthalene-1-sulfonic acid.
| Compound Name | 6-[[4-[(4-carbamoyl-3-cyanophenyl)diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]-5-hydroxynaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 146699059 |
| Molecular Formula | C28H18N6O8S2 |
| Molecular Weight | 630.62 g/mol |
| Exact Mass | 630.06 |
| IUPAC Name | 6-[[4-[(4-carbamoyl-3-cyanophenyl)diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]-5-hydroxynaphthalene-1-sulfonic acid |
| SMILES | N#Cc1cc(/N=N/c2ccc(/N=N/c3ccc4c(S(=O)(=O)O)cccc4c3O)c3cc(S(=O)(=O)O)ccc23)ccc1C(N)=O |
| InChI | InChI=1S/C28H18N6O8S2/c29-14-15-12-16(4-6-18(15)28(30)36)31-32-23-10-11-24(22-13-17(43(37,38)39)5-7-19(22)23)33-34-25-9-8-20-21(27(25)35)2-1-3-26(20)44(40,41)42/h1-13,35H,(H2,30,36)(H,37,38,39)(H,40,41,42)/b32-31+,34-33+ |
| InChIKey | QSGFVGPDACIBRL-HSBKYFPUSA-N |
| XLogP | 5.99 |
| TPSA | 245.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.62 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|