C11H10Br2N4O2S — CID 114389114
2,5-dibromo-N-(5,6-dimethyl-1,2,4-triazin-3-yl)benzenesulfonamide (PubChem CID 114389114) has the molecular formula C11H10Br2N4O2S and a molecular weight of 422.10 g/mol. Its IUPAC name is 2,5-dibromo-N-(5,6-dimethyl-1,2,4-triazin-3-yl)benzenesulfonamide.
| Compound Name | 2,5-dibromo-N-(5,6-dimethyl-1,2,4-triazin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 114389114 |
| Molecular Formula | C11H10Br2N4O2S |
| Molecular Weight | 422.10 g/mol |
| Exact Mass | 419.89 |
| IUPAC Name | 2,5-dibromo-N-(5,6-dimethyl-1,2,4-triazin-3-yl)benzenesulfonamide |
| SMILES | Cc1nnc(NS(=O)(=O)c2cc(Br)ccc2Br)nc1C |
| InChI | InChI=1S/C11H10Br2N4O2S/c1-6-7(2)15-16-11(14-6)17-20(18,19)10-5-8(12)3-4-9(10)13/h3-5H,1-2H3,(H,14,16,17) |
| InChIKey | HAMLQCBVLHMLMH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.10 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |