C21H25F3N3O2+ — CID 9197681
[2-[[(1S)-1-(4-ethylphenyl)ethyl]amino]-2-oxoethyl]-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium (PubChem CID 9197681) has the molecular formula C21H25F3N3O2+ and a molecular weight of 408.44 g/mol. Its IUPAC name is [2-[[(1S)-1-(4-ethylphenyl)ethyl]amino]-2-oxoethyl]-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium.
| Compound Name | [2-[[(1S)-1-(4-ethylphenyl)ethyl]amino]-2-oxoethyl]-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium |
|---|---|
| PubChem CID | 9197681 |
| Molecular Formula | C21H25F3N3O2+ |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | [2-[[(1S)-1-(4-ethylphenyl)ethyl]amino]-2-oxoethyl]-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium |
| SMILES | CCc1ccc([C@H](C)NC(=O)C[NH+](C)CC(=O)Nc2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C21H24F3N3O2/c1-4-14-5-7-15(8-6-14)13(2)25-18(28)11-27(3)12-19(29)26-17-10-9-16(22)20(23)21(17)24/h5-10,13H,4,11-12H2,1-3H3,(H,25,28)(H,26,29)/p+1/t13-/m0/s1 |
| InChIKey | UYWORQZYWYCLSV-ZDUSSCGKSA-O |
| XLogP | 2.00 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|