C17H23F3N3O2+ — CID 8550105
[2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl]-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium (PubChem CID 8550105) has the molecular formula C17H23F3N3O2+ and a molecular weight of 358.38 g/mol. Its IUPAC name is [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl]-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium.
| Compound Name | [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl]-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium |
|---|---|
| PubChem CID | 8550105 |
| Molecular Formula | C17H23F3N3O2+ |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl]-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium |
| SMILES | C=C(C)CN(CC)C(=O)C[NH+](C)CC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H22F3N3O2/c1-5-23(8-11(2)3)15(25)10-22(4)9-14(24)21-13-7-6-12(18)16(19)17(13)20/h6-7H,2,5,8-10H2,1,3-4H3,(H,21,24)/p+1 |
| InChIKey | MNAIJIVBJOZRAQ-UHFFFAOYSA-O |
| XLogP | 0.98 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|