C21H23N2O2+ — CID 2548867
(2-methoxyphenyl)methyl-methyl-[2-(naphthalen-1-ylamino)-2-oxoethyl]azanium (PubChem CID 2548867) has the molecular formula C21H23N2O2+ and a molecular weight of 335.43 g/mol. Its IUPAC name is (2-methoxyphenyl)methyl-methyl-[2-(naphthalen-1-ylamino)-2-oxoethyl]azanium.
| Compound Name | (2-methoxyphenyl)methyl-methyl-[2-(naphthalen-1-ylamino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 2548867 |
| Molecular Formula | C21H23N2O2+ |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | (2-methoxyphenyl)methyl-methyl-[2-(naphthalen-1-ylamino)-2-oxoethyl]azanium |
| SMILES | COc1ccccc1C[NH+](C)CC(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C21H22N2O2/c1-23(14-17-9-4-6-13-20(17)25-2)15-21(24)22-19-12-7-10-16-8-3-5-11-18(16)19/h3-13H,14-15H2,1-2H3,(H,22,24)/p+1 |
| InChIKey | XDXPCXCXSNMAHX-UHFFFAOYSA-O |
| XLogP | 2.50 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |