C18H21ClN3O4+ — CID 9136616
(5-chloro-2-methoxyphenyl)methyl-methyl-[2-(2-methyl-6-nitroanilino)-2-oxoethyl]azanium (PubChem CID 9136616) has the molecular formula C18H21ClN3O4+ and a molecular weight of 378.84 g/mol. Its IUPAC name is (5-chloro-2-methoxyphenyl)methyl-methyl-[2-(2-methyl-6-nitroanilino)-2-oxoethyl]azanium.
| Compound Name | (5-chloro-2-methoxyphenyl)methyl-methyl-[2-(2-methyl-6-nitroanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9136616 |
| Molecular Formula | C18H21ClN3O4+ |
| Molecular Weight | 378.84 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | (5-chloro-2-methoxyphenyl)methyl-methyl-[2-(2-methyl-6-nitroanilino)-2-oxoethyl]azanium |
| SMILES | COc1ccc(Cl)cc1C[NH+](C)CC(=O)Nc1c(C)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H20ClN3O4/c1-12-5-4-6-15(22(24)25)18(12)20-17(23)11-21(2)10-13-9-14(19)7-8-16(13)26-3/h4-9H,10-11H2,1-3H3,(H,20,23)/p+1 |
| InChIKey | JBKZFNCUQKBVCS-UHFFFAOYSA-O |
| XLogP | 2.22 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.84 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|