C24H27N4O3+ — CID 2470771
[2-(4-acetamidoanilino)-2-oxoethyl]-ethyl-[2-(naphthalen-1-ylamino)-2-oxoethyl]azanium (PubChem CID 2470771) has the molecular formula C24H27N4O3+ and a molecular weight of 419.51 g/mol. Its IUPAC name is [2-(4-acetamidoanilino)-2-oxoethyl]-ethyl-[2-(naphthalen-1-ylamino)-2-oxoethyl]azanium.
| Compound Name | [2-(4-acetamidoanilino)-2-oxoethyl]-ethyl-[2-(naphthalen-1-ylamino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 2470771 |
| Molecular Formula | C24H27N4O3+ |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | [2-(4-acetamidoanilino)-2-oxoethyl]-ethyl-[2-(naphthalen-1-ylamino)-2-oxoethyl]azanium |
| SMILES | CC[NH+](CC(=O)Nc1ccc(NC(C)=O)cc1)CC(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C24H26N4O3/c1-3-28(15-23(30)26-20-13-11-19(12-14-20)25-17(2)29)16-24(31)27-22-10-6-8-18-7-4-5-9-21(18)22/h4-14H,3,15-16H2,1-2H3,(H,25,29)(H,26,30)(H,27,31)/p+1 |
| InChIKey | LUOUKICJYBSSFY-UHFFFAOYSA-O |
| XLogP | 2.28 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |