C19H31N4O3+ — CID 9433372
[2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl]-ethyl-[2-(ethylamino)-2-oxoethyl]azanium (PubChem CID 9433372) has the molecular formula C19H31N4O3+ and a molecular weight of 363.48 g/mol. Its IUPAC name is [2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl]-ethyl-[2-(ethylamino)-2-oxoethyl]azanium.
| Compound Name | [2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl]-ethyl-[2-(ethylamino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9433372 |
| Molecular Formula | C19H31N4O3+ |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | [2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl]-ethyl-[2-(ethylamino)-2-oxoethyl]azanium |
| SMILES | CCNC(=O)C[NH+](CC)CC(=O)Nc1ccc(C(=O)N(CC)CC)cc1 |
| InChI | InChI=1S/C19H30N4O3/c1-5-20-17(24)13-22(6-2)14-18(25)21-16-11-9-15(10-12-16)19(26)23(7-3)8-4/h9-12H,5-8,13-14H2,1-4H3,(H,20,24)(H,21,25)/p+1 |
| InChIKey | BXRNLGFEDIVDOP-UHFFFAOYSA-O |
| XLogP | 0.15 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |