C20H25FN3O2S+ — CID 8791356
[2-(4-acetamidoanilino)-2-oxoethyl]-ethyl-[2-(2-fluorophenyl)sulfanylethyl]azanium (PubChem CID 8791356) has the molecular formula C20H25FN3O2S+ and a molecular weight of 390.50 g/mol. Its IUPAC name is [2-(4-acetamidoanilino)-2-oxoethyl]-ethyl-[2-(2-fluorophenyl)sulfanylethyl]azanium.
| Compound Name | [2-(4-acetamidoanilino)-2-oxoethyl]-ethyl-[2-(2-fluorophenyl)sulfanylethyl]azanium |
|---|---|
| PubChem CID | 8791356 |
| Molecular Formula | C20H25FN3O2S+ |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | [2-(4-acetamidoanilino)-2-oxoethyl]-ethyl-[2-(2-fluorophenyl)sulfanylethyl]azanium |
| SMILES | CC[NH+](CCSc1ccccc1F)CC(=O)Nc1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C20H24FN3O2S/c1-3-24(12-13-27-19-7-5-4-6-18(19)21)14-20(26)23-17-10-8-16(9-11-17)22-15(2)25/h4-11H,3,12-14H2,1-2H3,(H,22,25)(H,23,26)/p+1 |
| InChIKey | DXEKNGMAZRIEDF-UHFFFAOYSA-O |
| XLogP | 2.42 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |