C21H27FN3O2+ — CID 9348221
[2-(4-fluoroanilino)-2-oxoethyl]-methyl-[2-oxo-2-[[(1R)-1-phenylbutyl]amino]ethyl]azanium (PubChem CID 9348221) has the molecular formula C21H27FN3O2+ and a molecular weight of 372.46 g/mol. Its IUPAC name is [2-(4-fluoroanilino)-2-oxoethyl]-methyl-[2-oxo-2-[[(1R)-1-phenylbutyl]amino]ethyl]azanium.
| Compound Name | [2-(4-fluoroanilino)-2-oxoethyl]-methyl-[2-oxo-2-[[(1R)-1-phenylbutyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 9348221 |
| Molecular Formula | C21H27FN3O2+ |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | [2-(4-fluoroanilino)-2-oxoethyl]-methyl-[2-oxo-2-[[(1R)-1-phenylbutyl]amino]ethyl]azanium |
| SMILES | CCC[C@@H](NC(=O)C[NH+](C)CC(=O)Nc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H26FN3O2/c1-3-7-19(16-8-5-4-6-9-16)24-21(27)15-25(2)14-20(26)23-18-12-10-17(22)11-13-18/h4-6,8-13,19H,3,7,14-15H2,1-2H3,(H,23,26)(H,24,27)/p+1/t19-/m1/s1 |
| InChIKey | MRSUDVNBSGXYAF-LJQANCHMSA-O |
| XLogP | 1.94 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |