C17H25N4O6+ — CID 8711426
[2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl]-methyl-(2-morpholin-4-yl-2-oxoethyl)azanium (PubChem CID 8711426) has the molecular formula C17H25N4O6+ and a molecular weight of 381.41 g/mol. Its IUPAC name is [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl]-methyl-(2-morpholin-4-yl-2-oxoethyl)azanium.
| Compound Name | [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl]-methyl-(2-morpholin-4-yl-2-oxoethyl)azanium |
|---|---|
| PubChem CID | 8711426 |
| Molecular Formula | C17H25N4O6+ |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl]-methyl-(2-morpholin-4-yl-2-oxoethyl)azanium |
| SMILES | COc1cc(NC(=O)C[NH+](C)CC(=O)N2CCOCC2)c(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H24N4O6/c1-12-8-14(21(24)25)15(26-3)9-13(12)18-16(22)10-19(2)11-17(23)20-4-6-27-7-5-20/h8-9H,4-7,10-11H2,1-3H3,(H,18,22)/p+1 |
| InChIKey | YPKFXGHJMWRFGY-UHFFFAOYSA-O |
| XLogP | -0.78 |
| TPSA | 115.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|