C17H24N3O5+ — CID 8931602
ethyl 1-[2-(2-methyl-6-nitroanilino)-2-oxoethyl]piperidin-1-ium-4-carboxylate (PubChem CID 8931602) has the molecular formula C17H24N3O5+ and a molecular weight of 350.40 g/mol. Its IUPAC name is ethyl 1-[2-(2-methyl-6-nitroanilino)-2-oxoethyl]piperidin-1-ium-4-carboxylate.
| Compound Name | ethyl 1-[2-(2-methyl-6-nitroanilino)-2-oxoethyl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 8931602 |
| Molecular Formula | C17H24N3O5+ |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | ethyl 1-[2-(2-methyl-6-nitroanilino)-2-oxoethyl]piperidin-1-ium-4-carboxylate |
| SMILES | CCOC(=O)C1CC[NH+](CC(=O)Nc2c(C)cccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H23N3O5/c1-3-25-17(22)13-7-9-19(10-8-13)11-15(21)18-16-12(2)5-4-6-14(16)20(23)24/h4-6,13H,3,7-11H2,1-2H3,(H,18,21)/p+1 |
| InChIKey | YVGINLSVFKSAGI-UHFFFAOYSA-O |
| XLogP | 0.70 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|