C18H23N5O3+2 — CID 8547273
N-(2-methyl-6-nitrophenyl)-2-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)acetamide (PubChem CID 8547273) has the molecular formula C18H23N5O3+2 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-(2-methyl-6-nitrophenyl)-2-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)acetamide.
| Compound Name | N-(2-methyl-6-nitrophenyl)-2-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8547273 |
| Molecular Formula | C18H23N5O3+2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | N-(2-methyl-6-nitrophenyl)-2-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)acetamide |
| SMILES | Cc1cccc([N+](=O)[O-])c1NC(=O)C[NH+]1CCN(c2cccc[nH+]2)CC1 |
| InChI | InChI=1S/C18H21N5O3/c1-14-5-4-6-15(23(25)26)18(14)20-17(24)13-21-9-11-22(12-10-21)16-7-2-3-8-19-16/h2-8H,9-13H2,1H3,(H,20,24)/p+2 |
| InChIKey | FBTGELMJXINSQV-UHFFFAOYSA-P |
| XLogP | 0.06 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|