C22H27N4O4+ — CID 9021440
N-(2,6-dimethylphenyl)-2-[4-(3-methyl-4-nitrobenzoyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 9021440) has the molecular formula C22H27N4O4+ and a molecular weight of 411.48 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[4-(3-methyl-4-nitrobenzoyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[4-(3-methyl-4-nitrobenzoyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 9021440 |
| Molecular Formula | C22H27N4O4+ |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[4-(3-methyl-4-nitrobenzoyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | Cc1cc(C(=O)N2CC[NH+](CC(=O)Nc3c(C)cccc3C)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H26N4O4/c1-15-5-4-6-16(2)21(15)23-20(27)14-24-9-11-25(12-10-24)22(28)18-7-8-19(26(29)30)17(3)13-18/h4-8,13H,9-12,14H2,1-3H3,(H,23,27)/p+1 |
| InChIKey | LGGVJPYYIQSSIH-UHFFFAOYSA-O |
| XLogP | 1.50 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|