C20H21N4O3S+ — CID 8797010
[4-(1,3-benzothiazol-2-ylmethyl)piperazin-4-ium-1-yl]-(3-methyl-4-nitrophenyl)methanone (PubChem CID 8797010) has the molecular formula C20H21N4O3S+ and a molecular weight of 397.48 g/mol. Its IUPAC name is [4-(1,3-benzothiazol-2-ylmethyl)piperazin-4-ium-1-yl]-(3-methyl-4-nitrophenyl)methanone.
| Compound Name | [4-(1,3-benzothiazol-2-ylmethyl)piperazin-4-ium-1-yl]-(3-methyl-4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 8797010 |
| Molecular Formula | C20H21N4O3S+ |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | [4-(1,3-benzothiazol-2-ylmethyl)piperazin-4-ium-1-yl]-(3-methyl-4-nitrophenyl)methanone |
| SMILES | Cc1cc(C(=O)N2CC[NH+](Cc3nc4ccccc4s3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H20N4O3S/c1-14-12-15(6-7-17(14)24(26)27)20(25)23-10-8-22(9-11-23)13-19-21-16-4-2-3-5-18(16)28-19/h2-7,12H,8-11,13H2,1H3/p+1 |
| InChIKey | URMHXRZJNTXWLK-UHFFFAOYSA-O |
| XLogP | 2.05 |
| TPSA | 80.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|