C17H20N3O5+ — CID 7357078
prop-2-ynyl (3S)-4-(2-nitroanilino)-4-oxo-3-pyrrolidin-1-ium-1-ylbutanoate (PubChem CID 7357078) has the molecular formula C17H20N3O5+ and a molecular weight of 346.36 g/mol. Its IUPAC name is prop-2-ynyl (3S)-4-(2-nitroanilino)-4-oxo-3-pyrrolidin-1-ium-1-ylbutanoate.
| Compound Name | prop-2-ynyl (3S)-4-(2-nitroanilino)-4-oxo-3-pyrrolidin-1-ium-1-ylbutanoate |
|---|---|
| PubChem CID | 7357078 |
| Molecular Formula | C17H20N3O5+ |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | prop-2-ynyl (3S)-4-(2-nitroanilino)-4-oxo-3-pyrrolidin-1-ium-1-ylbutanoate |
| SMILES | C#CCOC(=O)CC(C(=O)Nc1ccccc1[N+](=O)[O-])[NH+]1CCCC1 |
| InChI | InChI=1S/C17H19N3O5/c1-2-11-25-16(21)12-15(19-9-5-6-10-19)17(22)18-13-7-3-4-8-14(13)20(23)24/h1,3-4,7-8,15H,5-6,9-12H2,(H,18,22)/p+1 |
| InChIKey | SORIJMJCVBSPPG-UHFFFAOYSA-O |
| XLogP | 0.15 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|