C22H21N3O5 — CID 26478674
prop-2-ynyl (3S)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-4-(2-nitroanilino)-4-oxobutanoate (PubChem CID 26478674) has the molecular formula C22H21N3O5 and a molecular weight of 407.43 g/mol. Its IUPAC name is prop-2-ynyl (3S)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-4-(2-nitroanilino)-4-oxobutanoate.
| Compound Name | prop-2-ynyl (3S)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-4-(2-nitroanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 26478674 |
| Molecular Formula | C22H21N3O5 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | prop-2-ynyl (3S)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-4-(2-nitroanilino)-4-oxobutanoate |
| SMILES | C#CCOC(=O)C[C@@H](C(=O)Nc1ccccc1[N+](=O)[O-])N1CCc2ccccc2C1 |
| InChI | InChI=1S/C22H21N3O5/c1-2-13-30-21(26)14-20(24-12-11-16-7-3-4-8-17(16)15-24)22(27)23-18-9-5-6-10-19(18)25(28)29/h1,3-10,20H,11-15H2,(H,23,27)/t20-/m0/s1 |
| InChIKey | VKEITUDFTNTGQJ-FQEVSTJZSA-N |
| XLogP | 2.53 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|