C21H25N4O7S+ — CID 2442893
(2S)-N-(1,3-benzodioxol-5-ylmethyl)-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-ium-1-yl]propanamide (PubChem CID 2442893) has the molecular formula C21H25N4O7S+ and a molecular weight of 477.52 g/mol. Its IUPAC name is (2S)-N-(1,3-benzodioxol-5-ylmethyl)-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-ium-1-yl]propanamide.
| Compound Name | (2S)-N-(1,3-benzodioxol-5-ylmethyl)-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-ium-1-yl]propanamide |
|---|---|
| PubChem CID | 2442893 |
| Molecular Formula | C21H25N4O7S+ |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | (2S)-N-(1,3-benzodioxol-5-ylmethyl)-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-ium-1-yl]propanamide |
| SMILES | C[C@@H](C(=O)NCc1ccc2c(c1)OCO2)[NH+]1CCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C21H24N4O7S/c1-15(21(26)22-13-16-6-7-18-19(12-16)32-14-31-18)23-8-10-24(11-9-23)33(29,30)20-5-3-2-4-17(20)25(27)28/h2-7,12,15H,8-11,13-14H2,1H3,(H,22,26)/p+1/t15-/m0/s1 |
| InChIKey | ITJWTNSWPRNTQS-HNNXBMFYSA-O |
| XLogP | -0.08 |
| TPSA | 132.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|