C14H15Cl2FN2O3S — CID 78780160
(2,2-dichlorocyclopropyl)-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 78780160) has the molecular formula C14H15Cl2FN2O3S and a molecular weight of 381.26 g/mol. Its IUPAC name is (2,2-dichlorocyclopropyl)-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (2,2-dichlorocyclopropyl)-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 78780160 |
| Molecular Formula | C14H15Cl2FN2O3S |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | (2,2-dichlorocyclopropyl)-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | O=C(C1CC1(Cl)Cl)N1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C14H15Cl2FN2O3S/c15-14(16)9-10(14)13(20)18-5-7-19(8-6-18)23(21,22)12-4-2-1-3-11(12)17/h1-4,10H,5-9H2 |
| InChIKey | JIVFQIFHYKUKIZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|