C19H34N4O4S — CID 22552859
1-[1-[cyclohexyl(methyl)sulfamoyl]piperidine-3-carbonyl]piperidine-4-carboxamide (PubChem CID 22552859) has the molecular formula C19H34N4O4S and a molecular weight of 414.57 g/mol. Its IUPAC name is 1-[1-[cyclohexyl(methyl)sulfamoyl]piperidine-3-carbonyl]piperidine-4-carboxamide.
| Compound Name | 1-[1-[cyclohexyl(methyl)sulfamoyl]piperidine-3-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 22552859 |
| Molecular Formula | C19H34N4O4S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 1-[1-[cyclohexyl(methyl)sulfamoyl]piperidine-3-carbonyl]piperidine-4-carboxamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)N1CCCC(C(=O)N2CCC(C(N)=O)CC2)C1 |
| InChI | InChI=1S/C19H34N4O4S/c1-21(17-7-3-2-4-8-17)28(26,27)23-11-5-6-16(14-23)19(25)22-12-9-15(10-13-22)18(20)24/h15-17H,2-14H2,1H3,(H2,20,24) |
| InChIKey | OQFBAPROYFDUJH-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 104.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |