C13H23N3O4S — CID 45372000
1-(1-methylsulfonylpiperidine-3-carbonyl)piperidine-4-carboxamide (PubChem CID 45372000) has the molecular formula C13H23N3O4S and a molecular weight of 317.41 g/mol. Its IUPAC name is 1-(1-methylsulfonylpiperidine-3-carbonyl)piperidine-4-carboxamide.
| Compound Name | 1-(1-methylsulfonylpiperidine-3-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 45372000 |
| Molecular Formula | C13H23N3O4S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 1-(1-methylsulfonylpiperidine-3-carbonyl)piperidine-4-carboxamide |
| SMILES | CS(=O)(=O)N1CCCC(C(=O)N2CCC(C(N)=O)CC2)C1 |
| InChI | InChI=1S/C13H23N3O4S/c1-21(19,20)16-6-2-3-11(9-16)13(18)15-7-4-10(5-8-15)12(14)17/h10-11H,2-9H2,1H3,(H2,14,17) |
| InChIKey | RFLFEQXMWXMIID-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |