C11H25N3O2S — CID 63854361
3-(1-aminoethyl)-N,N-diethylpiperidine-1-sulfonamide (PubChem CID 63854361) has the molecular formula C11H25N3O2S and a molecular weight of 263.41 g/mol. Its IUPAC name is 3-(1-aminoethyl)-N,N-diethylpiperidine-1-sulfonamide.
| Compound Name | 3-(1-aminoethyl)-N,N-diethylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 63854361 |
| Molecular Formula | C11H25N3O2S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 3-(1-aminoethyl)-N,N-diethylpiperidine-1-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCCC(C(C)N)C1 |
| InChI | InChI=1S/C11H25N3O2S/c1-4-13(5-2)17(15,16)14-8-6-7-11(9-14)10(3)12/h10-11H,4-9,12H2,1-3H3 |
| InChIKey | FMEOCTXHDHZTIB-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |