C10H21BrN2O2S — CID 104556348
N-(1-bromopropan-2-yl)-N,3-dimethylpiperidine-1-sulfonamide (PubChem CID 104556348) has the molecular formula C10H21BrN2O2S and a molecular weight of 313.26 g/mol. Its IUPAC name is N-(1-bromopropan-2-yl)-N,3-dimethylpiperidine-1-sulfonamide.
| Compound Name | N-(1-bromopropan-2-yl)-N,3-dimethylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 104556348 |
| Molecular Formula | C10H21BrN2O2S |
| Molecular Weight | 313.26 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | N-(1-bromopropan-2-yl)-N,3-dimethylpiperidine-1-sulfonamide |
| SMILES | CC1CCCN(S(=O)(=O)N(C)C(C)CBr)C1 |
| InChI | InChI=1S/C10H21BrN2O2S/c1-9-5-4-6-13(8-9)16(14,15)12(3)10(2)7-11/h9-10H,4-8H2,1-3H3 |
| InChIKey | NGXFIJKHROMJQM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.26 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|