C12H23BrN2O2S — CID 80674883
N-[(3-bromocyclobutyl)methyl]-N,3-dimethylpiperidine-1-sulfonamide (PubChem CID 80674883) has the molecular formula C12H23BrN2O2S and a molecular weight of 339.30 g/mol. Its IUPAC name is N-[(3-bromocyclobutyl)methyl]-N,3-dimethylpiperidine-1-sulfonamide.
| Compound Name | N-[(3-bromocyclobutyl)methyl]-N,3-dimethylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 80674883 |
| Molecular Formula | C12H23BrN2O2S |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | N-[(3-bromocyclobutyl)methyl]-N,3-dimethylpiperidine-1-sulfonamide |
| SMILES | CC1CCCN(S(=O)(=O)N(C)CC2CC(Br)C2)C1 |
| InChI | InChI=1S/C12H23BrN2O2S/c1-10-4-3-5-15(8-10)18(16,17)14(2)9-11-6-12(13)7-11/h10-12H,3-9H2,1-2H3 |
| InChIKey | JFWZZNLBKSOPGI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|