C10H21N3O4S2 — CID 63285308
3-[2-methoxyethyl(morpholin-4-ylsulfonyl)amino]propanethioamide (PubChem CID 63285308) has the molecular formula C10H21N3O4S2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 3-[2-methoxyethyl(morpholin-4-ylsulfonyl)amino]propanethioamide.
| Compound Name | 3-[2-methoxyethyl(morpholin-4-ylsulfonyl)amino]propanethioamide |
|---|---|
| PubChem CID | 63285308 |
| Molecular Formula | C10H21N3O4S2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 3-[2-methoxyethyl(morpholin-4-ylsulfonyl)amino]propanethioamide |
| SMILES | COCCN(CCC(N)=S)S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C10H21N3O4S2/c1-16-7-4-12(3-2-10(11)18)19(14,15)13-5-8-17-9-6-13/h2-9H2,1H3,(H2,11,18) |
| InChIKey | UFYQGDJPCUAGGO-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|