C10H18N4O3S2 — CID 104709936
3-[2-methoxyethyl-(2-methylpyrazol-3-yl)sulfonylamino]propanethioamide (PubChem CID 104709936) has the molecular formula C10H18N4O3S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 3-[2-methoxyethyl-(2-methylpyrazol-3-yl)sulfonylamino]propanethioamide.
| Compound Name | 3-[2-methoxyethyl-(2-methylpyrazol-3-yl)sulfonylamino]propanethioamide |
|---|---|
| PubChem CID | 104709936 |
| Molecular Formula | C10H18N4O3S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 3-[2-methoxyethyl-(2-methylpyrazol-3-yl)sulfonylamino]propanethioamide |
| SMILES | COCCN(CCC(N)=S)S(=O)(=O)c1ccnn1C |
| InChI | InChI=1S/C10H18N4O3S2/c1-13-10(3-5-12-13)19(15,16)14(7-8-17-2)6-4-9(11)18/h3,5H,4,6-8H2,1-2H3,(H2,11,18) |
| InChIKey | DAGAIFCDOGQLQF-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|