C11H22N2O5S3 — CID 63287722
3-[(1,1-dioxothian-4-yl)sulfonyl-(2-methoxyethyl)amino]propanethioamide (PubChem CID 63287722) has the molecular formula C11H22N2O5S3 and a molecular weight of 358.51 g/mol. Its IUPAC name is 3-[(1,1-dioxothian-4-yl)sulfonyl-(2-methoxyethyl)amino]propanethioamide.
| Compound Name | 3-[(1,1-dioxothian-4-yl)sulfonyl-(2-methoxyethyl)amino]propanethioamide |
|---|---|
| PubChem CID | 63287722 |
| Molecular Formula | C11H22N2O5S3 |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 3-[(1,1-dioxothian-4-yl)sulfonyl-(2-methoxyethyl)amino]propanethioamide |
| SMILES | COCCN(CCC(N)=S)S(=O)(=O)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H22N2O5S3/c1-18-7-6-13(5-2-11(12)19)21(16,17)10-3-8-20(14,15)9-4-10/h10H,2-9H2,1H3,(H2,12,19) |
| InChIKey | DZFDUBPVVROOGG-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|