C10H20BrNO5S2 — CID 80672658
N-(2-bromo-3-methoxypropyl)-N-methyl-1,1-dioxothiane-4-sulfonamide (PubChem CID 80672658) has the molecular formula C10H20BrNO5S2 and a molecular weight of 378.31 g/mol. Its IUPAC name is N-(2-bromo-3-methoxypropyl)-N-methyl-1,1-dioxothiane-4-sulfonamide.
| Compound Name | N-(2-bromo-3-methoxypropyl)-N-methyl-1,1-dioxothiane-4-sulfonamide |
|---|---|
| PubChem CID | 80672658 |
| Molecular Formula | C10H20BrNO5S2 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 377.00 |
| IUPAC Name | N-(2-bromo-3-methoxypropyl)-N-methyl-1,1-dioxothiane-4-sulfonamide |
| SMILES | COCC(Br)CN(C)S(=O)(=O)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H20BrNO5S2/c1-12(7-9(11)8-17-2)19(15,16)10-3-5-18(13,14)6-4-10/h9-10H,3-8H2,1-2H3 |
| InChIKey | DICJRVIODHLMJI-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|