C8H17NO4S — CID 64554742
N-(2-hydroxy-3-methoxypropyl)-N-methylcyclopropanesulfonamide (PubChem CID 64554742) has the molecular formula C8H17NO4S and a molecular weight of 223.29 g/mol. Its IUPAC name is N-(2-hydroxy-3-methoxypropyl)-N-methylcyclopropanesulfonamide.
| Compound Name | N-(2-hydroxy-3-methoxypropyl)-N-methylcyclopropanesulfonamide |
|---|---|
| PubChem CID | 64554742 |
| Molecular Formula | C8H17NO4S |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | N-(2-hydroxy-3-methoxypropyl)-N-methylcyclopropanesulfonamide |
| SMILES | COCC(O)CN(C)S(=O)(=O)C1CC1 |
| InChI | InChI=1S/C8H17NO4S/c1-9(5-7(10)6-13-2)14(11,12)8-3-4-8/h7-8,10H,3-6H2,1-2H3 |
| InChIKey | BPMKKSFLFCBKLD-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |