C8H19NO6S2 — CID 63242741
N-(2-hydroxy-3-methoxypropyl)-N-methyl-2-methylsulfonylethanesulfonamide (PubChem CID 63242741) has the molecular formula C8H19NO6S2 and a molecular weight of 289.38 g/mol. Its IUPAC name is N-(2-hydroxy-3-methoxypropyl)-N-methyl-2-methylsulfonylethanesulfonamide.
| Compound Name | N-(2-hydroxy-3-methoxypropyl)-N-methyl-2-methylsulfonylethanesulfonamide |
|---|---|
| PubChem CID | 63242741 |
| Molecular Formula | C8H19NO6S2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | N-(2-hydroxy-3-methoxypropyl)-N-methyl-2-methylsulfonylethanesulfonamide |
| SMILES | COCC(O)CN(C)S(=O)(=O)CCS(C)(=O)=O |
| InChI | InChI=1S/C8H19NO6S2/c1-9(6-8(10)7-15-2)17(13,14)5-4-16(3,11)12/h8,10H,4-7H2,1-3H3 |
| InChIKey | BVKFOQLBRJLHRA-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |