C11H24N2O4S2 — CID 62086183
N-(3-aminopropyl)-1,1-dioxo-N-propan-2-ylthiane-4-sulfonamide (PubChem CID 62086183) has the molecular formula C11H24N2O4S2 and a molecular weight of 312.46 g/mol. Its IUPAC name is N-(3-aminopropyl)-1,1-dioxo-N-propan-2-ylthiane-4-sulfonamide.
| Compound Name | N-(3-aminopropyl)-1,1-dioxo-N-propan-2-ylthiane-4-sulfonamide |
|---|---|
| PubChem CID | 62086183 |
| Molecular Formula | C11H24N2O4S2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | N-(3-aminopropyl)-1,1-dioxo-N-propan-2-ylthiane-4-sulfonamide |
| SMILES | CC(C)N(CCCN)S(=O)(=O)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H24N2O4S2/c1-10(2)13(7-3-6-12)19(16,17)11-4-8-18(14,15)9-5-11/h10-11H,3-9,12H2,1-2H3 |
| InChIKey | OWVZGGVVCWZUMZ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |