C12H23NO6S2 — CID 62083694
4-[(1,1-dioxothian-4-yl)sulfonyl-propan-2-ylamino]butanoic acid (PubChem CID 62083694) has the molecular formula C12H23NO6S2 and a molecular weight of 341.45 g/mol. Its IUPAC name is 4-[(1,1-dioxothian-4-yl)sulfonyl-propan-2-ylamino]butanoic acid.
| Compound Name | 4-[(1,1-dioxothian-4-yl)sulfonyl-propan-2-ylamino]butanoic acid |
|---|---|
| PubChem CID | 62083694 |
| Molecular Formula | C12H23NO6S2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 4-[(1,1-dioxothian-4-yl)sulfonyl-propan-2-ylamino]butanoic acid |
| SMILES | CC(C)N(CCCC(=O)O)S(=O)(=O)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H23NO6S2/c1-10(2)13(7-3-4-12(14)15)21(18,19)11-5-8-20(16,17)9-6-11/h10-11H,3-9H2,1-2H3,(H,14,15) |
| InChIKey | SOXQPTCCQBTWQK-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |