C11H21NO6S2 — CID 62827612
3-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]butanoic acid (PubChem CID 62827612) has the molecular formula C11H21NO6S2 and a molecular weight of 327.42 g/mol. Its IUPAC name is 3-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]butanoic acid.
| Compound Name | 3-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]butanoic acid |
|---|---|
| PubChem CID | 62827612 |
| Molecular Formula | C11H21NO6S2 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 3-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]butanoic acid |
| SMILES | CCN(C(C)CC(=O)O)S(=O)(=O)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H21NO6S2/c1-3-12(9(2)8-11(13)14)20(17,18)10-4-6-19(15,16)7-5-10/h9-10H,3-8H2,1-2H3,(H,13,14) |
| InChIKey | HHEHSPOHWLUFSC-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |