About 3-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]-2-methylpropanethioamide
3-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]-2-methylpropanethioamide (PubChem CID 62084238) has the molecular formula C11H22N2O4S3
and a molecular weight of 342.51 g/mol. Its IUPAC name is 3-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]-2-methylpropanethioamide.
Molecular Properties
| Compound Name | 3-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]-2-methylpropanethioamide |
| PubChem CID | 62084238 |
| Molecular Formula | C11H22N2O4S3 |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 3-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]-2-methylpropanethioamide |
| SMILES | CCN(CC(C)C(N)=S)S(=O)(=O)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H22N2O4S3/c1-3-13(8-9(2)11(12)18)20(16,17)10-4-6-19(14,15)7-5-10/h9-10H,3-8H2,1-2H3,(H2,12,18) |
| InChIKey | CBMSBUMCLQBCJA-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]-2-methylpropanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]-2-methylpropanethioamide?
The IUPAC name of 3-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]-2-methylpropanethioamide (CID 62084238) is 3-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]-2-methylpropanethioamide.
What is the SMILES notation for 3-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]-2-methylpropanethioamide?
The canonical SMILES for 3-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]-2-methylpropanethioamide is CCN(CC(C)C(N)=S)S(=O)(=O)C1CCS(=O)(=O)CC1.
What is the InChIKey of 3-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]-2-methylpropanethioamide?
The InChIKey is CBMSBUMCLQBCJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O4S3/c1-3-13(8-9(2)11(12)18)20(16,17)10-4-6-19(14,15)7-5-10/h9-10H,3-8H2,1-2H3,(H2,12,18).
What are the key properties of 3-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]-2-methylpropanethioamide?
3-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]-2-methylpropanethioamide has a molecular weight of 342.51 g/mol, XLogP of 0.14, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]-2-methylpropanethioamide is sourced from PubChem (CID 62084238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).