C11H22N2O4S3 — CID 62084238
3-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]-2-methylpropanethioamide (PubChem CID 62084238) has the molecular formula C11H22N2O4S3 and a molecular weight of 342.51 g/mol. Its IUPAC name is 3-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]-2-methylpropanethioamide.
| Compound Name | 3-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]-2-methylpropanethioamide |
|---|---|
| PubChem CID | 62084238 |
| Molecular Formula | C11H22N2O4S3 |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 3-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]-2-methylpropanethioamide |
| SMILES | CCN(CC(C)C(N)=S)S(=O)(=O)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H22N2O4S3/c1-3-13(8-9(2)11(12)18)20(16,17)10-4-6-19(14,15)7-5-10/h9-10H,3-8H2,1-2H3,(H2,12,18) |
| InChIKey | CBMSBUMCLQBCJA-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|