ethyl 2-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]acetate

C11H21NO6S2 — CID 62085138

IUPACethyl 2-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]acetate
SMILESCCOC(=O)CN(CC)S(=O)(=O)C1CCS(=O)(=O)CC1
InChIInChI=1S/C11H21NO6S2/c1-3-12(9-11(13)18-4-2)20(16,17)10-5-7-19(14,15)8-6-10/h10H,3-9H2,1-2H3
InChIKeyQFPYRJAWLWOHBK-UHFFFAOYSA-N
MW327.42 g/mol
LogP-0.22
Rot. Bonds6

About ethyl 2-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]acetate

ethyl 2-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]acetate (PubChem CID 62085138) has the molecular formula C11H21NO6S2 and a molecular weight of 327.42 g/mol. Its IUPAC name is ethyl 2-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]acetate.

Molecular Properties

Compound Nameethyl 2-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]acetate
PubChem CID62085138
Molecular FormulaC11H21NO6S2
Molecular Weight327.42 g/mol
Exact Mass327.08
IUPAC Nameethyl 2-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]acetate
SMILESCCOC(=O)CN(CC)S(=O)(=O)C1CCS(=O)(=O)CC1
InChIInChI=1S/C11H21NO6S2/c1-3-12(9-11(13)18-4-2)20(16,17)10-5-7-19(14,15)8-6-10/h10H,3-9H2,1-2H3
InChIKeyQFPYRJAWLWOHBK-UHFFFAOYSA-N
XLogP-0.22
TPSA97.82 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500327.42
LogP ≤ 5-0.22
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze ethyl 2-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]acetate?
The IUPAC name of ethyl 2-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]acetate (CID 62085138) is ethyl 2-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]acetate.
What is the SMILES notation for ethyl 2-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]acetate?
The canonical SMILES for ethyl 2-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]acetate is CCOC(=O)CN(CC)S(=O)(=O)C1CCS(=O)(=O)CC1.
What is the InChIKey of ethyl 2-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]acetate?
The InChIKey is QFPYRJAWLWOHBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO6S2/c1-3-12(9-11(13)18-4-2)20(16,17)10-5-7-19(14,15)8-6-10/h10H,3-9H2,1-2H3.
What are the key properties of ethyl 2-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]acetate?
ethyl 2-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]acetate has a molecular weight of 327.42 g/mol, XLogP of -0.22, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]acetate is sourced from PubChem (CID 62085138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).