C11H21NO6S2 — CID 62085138
ethyl 2-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]acetate (PubChem CID 62085138) has the molecular formula C11H21NO6S2 and a molecular weight of 327.42 g/mol. Its IUPAC name is ethyl 2-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]acetate.
| Compound Name | ethyl 2-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]acetate |
|---|---|
| PubChem CID | 62085138 |
| Molecular Formula | C11H21NO6S2 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | ethyl 2-[(1,1-dioxothian-4-yl)sulfonyl-ethylamino]acetate |
| SMILES | CCOC(=O)CN(CC)S(=O)(=O)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H21NO6S2/c1-3-12(9-11(13)18-4-2)20(16,17)10-5-7-19(14,15)8-6-10/h10H,3-9H2,1-2H3 |
| InChIKey | QFPYRJAWLWOHBK-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |