C9H19NO5S2 — CID 62086021
N-ethyl-N-(2-hydroxyethyl)-1,1-dioxothiane-4-sulfonamide (PubChem CID 62086021) has the molecular formula C9H19NO5S2 and a molecular weight of 285.39 g/mol. Its IUPAC name is N-ethyl-N-(2-hydroxyethyl)-1,1-dioxothiane-4-sulfonamide.
| Compound Name | N-ethyl-N-(2-hydroxyethyl)-1,1-dioxothiane-4-sulfonamide |
|---|---|
| PubChem CID | 62086021 |
| Molecular Formula | C9H19NO5S2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | N-ethyl-N-(2-hydroxyethyl)-1,1-dioxothiane-4-sulfonamide |
| SMILES | CCN(CCO)S(=O)(=O)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C9H19NO5S2/c1-2-10(5-6-11)17(14,15)9-3-7-16(12,13)8-4-9/h9,11H,2-8H2,1H3 |
| InChIKey | SKFJWOLKOXYTOB-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |